![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| A Target Stud (2017) Korean HDRip.mp4 | 2018-01-03 18:52 | 696M | |
| A Wedding to Die For (2017) HDTV.mp4 | 2018-01-03 19:12 | 1.0G | |
| Bunny The Perfect Gentleman (2016) Hindi.Dubbed WEBHD.MP4 | 2018-01-03 18:57 | 1.9G | |
| Death Island (2017) HDRip.avi | 2018-01-03 18:16 | 1.2G | |
| Desire (2017) WEBRip.mp4 | 2018-01-03 18:49 | 700M | |
| Geostorm (2017) WEB-DL.mkv | 2018-01-03 18:35 | 950M | |
| Happy Death Day (2017) WEB-DL.mp4 | 2018-01-03 19:57 | 838M | |
| Hogi Pyaar Ki Jeet (1999).mp4 | 2018-01-03 20:03 | 931M | |
| Ittefaq (2017) DVDRip.mkv | 2018-01-03 18:09 | 1.4G | |
| Lucky (2017) HDRip.avi | 2018-01-03 19:13 | 1.4G | |
| Masterpiece (2017) DVDScr.mkv | 2018-01-03 19:50 | 1.4G | |
| Mathangi (2017) WEBHD.mkv | 2018-01-03 18:29 | 1.6G | |
| Maze (2017) WEBRip.mp4 | 2018-01-03 18:39 | 651M | |
| Muay Thai Chaiya (2007) Dual Audio 720p BluRay.mkv | 2018-01-03 20:10 | 1.3G | |
| Return to Montauk (2017) 720p BluRay.mp4 | 2018-01-03 19:56 | 775M | |
| The Light of the Moon (2017) HDRip.avi | 2018-01-03 18:39 | 1.4G | |
| Wonderstruck (2017) HDRip.avi | 2018-01-03 20:06 | 1.4G | |