![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Andrei Rublev (1966) 1080p BluRay.mp4 | 2018-02-18 19:23 | 3.5G | |
| Carnera The Walking Mountain (2008) 720p BluRay.mp4 | 2018-02-18 19:57 | 1.1G | |
| Luv Shuv Pyar Vyar (2017) HDRip.mp4 | 2018-02-18 18:01 | 1.0G | |
| Tumhari Sulu (2017) DVDRip.mkv | 2018-02-18 18:03 | 1.0G | |
| The Happiest Day in the Life of Olli Mäki (2016) 720p BluRay.mp4 | 2018-02-18 18:39 | 861M | |
| Bright Lights Starring Carrie Fisher and Debbie Reynolds (2016) WEBRip.mp4 | 2018-02-18 18:46 | 860M | |
| Columbus (2017) WEBRip.mp4 | 2018-02-18 18:14 | 810M | |
| Union Leader (2017) HDTVRip.mp4 | 2018-02-18 18:03 | 675M | |
| One Under the Sun (2017) WEBRip.mkv | 2018-02-18 18:15 | 672M | |
| To Keep the Light (2016) 720p BluRay.mp4 | 2018-02-18 18:16 | 651M | |
| Vaigai Express (2017) Hindi Dubbed HDRip.mkv | 2018-02-18 18:06 | 600M | |
| Chasuke's Journey (2015).mkv | 2018-02-18 19:33 | 401M | |
| McMafia Season 1 Complete/ | 2018-02-18 21:38 | - | |
| Everything Sucks! Season 1 Complete/ | 2018-02-18 21:34 | - | |