![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| The Circle (2017) 720p BluRay.mp4 | 2017-11-09 15:12 | 812M | |
| Unfallen (2017) WEBRip.mkv | 2017-11-10 15:03 | 1.6G | |
| Valerian and the City of a Thousand Planets (2017) 720p BluRay.mp4 | 2017-11-10 15:03 | 1.7G | |
| Totem (2017) WEB-DL.mkv | 2017-11-10 15:18 | 1.6G | |
| The Wishing Tree (2017) HDRip.mkv | 2017-11-10 15:20 | 844M | |
| The Next Three Days (2010) 1080p BluRay.mp4 | 2017-11-10 15:30 | 1.7G | |
| The Calling (2014) WEBRip.mp4 | 2017-11-10 15:30 | 929M | |
| The Elf (2017) HDRip.MP4 | 2017-11-10 15:37 | 774M | |
| The Loved Ones (2009) 720p BluRay.mkv | 2017-11-10 15:43 | 651M | |
| The Fortress (2017) 720p BluRay.mkv | 2017-11-10 15:46 | 1.1G | |
| Traffic (2011) DVDRip.mkv | 2017-11-10 16:30 | 637M | |
| 51st Annual CMA Awards (2017).mkv | 2017-11-10 17:03 | 1.0G | |
| Blade of the Immortal (2017) 720p BluRay.mkv | 2017-11-11 13:48 | 904M | |
| Radius (2017) WEB-DL.mkv | 2017-11-11 13:56 | 752M | |
| The Legend of Lucy Keyes (2005).MP4 | 2017-11-11 18:03 | 670M | |
| Raw (2016) 720p BluRay.mkv | 2017-11-11 19:21 | 902M | |
| Don Ki Jung (2017) HDRip.mp4 | 2017-11-11 19:25 | 820M | |