![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Autohead (2016) WEB-HD.mkv | 2017-11-12 12:09 | 1.5G | |
| Bareilly Ki Barfi (2017) 720p BluRay.mkv | 2017-11-12 12:13 | 3.0G | |
| M.F.A. (2017) 1080p BluRay.mp4 | 2017-11-12 12:14 | 1.8G | |
| Lucknow Central (2017) DVDRip.mkv | 2017-11-12 12:18 | 1.5G | |
| The Nile Hilton Incident (2017) 720p BluRay.mp4 | 2017-11-12 12:18 | 904M | |
| Barracuda (2017) WEBRip.mp4 | 2017-11-12 12:19 | 750M | |
| Summer of '42 (1971) 720p BluRay.mp4 | 2017-11-12 12:28 | 736M | |
| Suspect (1987) 720p BluRay.mp4 | 2017-11-12 12:33 | 901M | |
| Cemetery Man (1994) 720p BluRay.mp4 | 2017-11-12 12:37 | 728M | |
| Whisky Galore (2016) 720p BluRay.mp4 | 2017-11-12 13:01 | 722M | |
| Complete Unknown (2016) 720p BluRay.mp4 | 2017-11-12 13:06 | 644M | |
| The Healer (2017) 720p BluRay.mp4 | 2017-11-12 13:14 | 788M | |
| Love of My Life (2017) 720p BluRay.mp4 | 2017-11-12 13:19 | 762M | |
| BloodRayne (2005) 1080p BluRay.mp4 | 2017-11-12 15:15 | 1.4G | |
| BloodRayne 2 Deliverance (2007) 1080p BluRay.mp4 | 2017-11-12 15:15 | 1.4G | |
| BloodRayne The Third Reich (2011) 1080p BluRay.mp4 | 2017-11-12 15:15 | 1.1G | |